C25H34ClN3O4 — CID 156851532
N-[1-[(5-chloro-2-ethoxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylbutanamide;N-ethylformamide (PubChem CID 156851532) has the molecular formula C25H34ClN3O4 and a molecular weight of 476.02 g/mol. Its IUPAC name is N-[1-[(5-chloro-2-ethoxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylbutanamide;N-ethylformamide.
| Compound Name | N-[1-[(5-chloro-2-ethoxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylbutanamide;N-ethylformamide |
|---|---|
| PubChem CID | 156851532 |
| Molecular Formula | C25H34ClN3O4 |
| Molecular Weight | 476.02 g/mol |
| Exact Mass | 475.22 |
| IUPAC Name | N-[1-[(5-chloro-2-ethoxyphenyl)methylamino]-1-oxopropan-2-yl]-4-phenylbutanamide;N-ethylformamide |
| SMILES | CCNC=O.CCOc1ccc(Cl)cc1CNC(=O)C(C)NC(=O)CCCc1ccccc1 |
| InChI | InChI=1S/C22H27ClN2O3.C3H7NO/c1-3-28-20-13-12-19(23)14-18(20)15-24-22(27)16(2)25-21(26)11-7-10-17-8-5-4-6-9-17;1-2-4-3-5/h4-6,8-9,12-14,16H,3,7,10-11,15H2,1-2H3,(H,24,27)(H,25,26);3H,2H2,1H3,(H,4,5) |
| InChIKey | QSDJDOHGDCSEDF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.02 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|