C21H24BrN — CID 144906483
2-benzyl-1-(3-bromophenyl)-3-cyclobutylbutan-1-imine (PubChem CID 144906483) has the molecular formula C21H24BrN and a molecular weight of 370.33 g/mol. Its IUPAC name is 2-benzyl-1-(3-bromophenyl)-3-cyclobutylbutan-1-imine.
| Compound Name | 2-benzyl-1-(3-bromophenyl)-3-cyclobutylbutan-1-imine |
|---|---|
| PubChem CID | 144906483 |
| Molecular Formula | C21H24BrN |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 369.11 |
| IUPAC Name | 2-benzyl-1-(3-bromophenyl)-3-cyclobutylbutan-1-imine |
| SMILES | [H]/N=C(\c1cccc(Br)c1)C(Cc1ccccc1)C(C)C1CCC1 |
| InChI | InChI=1S/C21H24BrN/c1-15(17-9-5-10-17)20(13-16-7-3-2-4-8-16)21(23)18-11-6-12-19(22)14-18/h2-4,6-8,11-12,14-15,17,20,23H,5,9-10,13H2,1H3/b23-21+ |
| InChIKey | CFUDLAUDXOYFKT-XTQSDGFTSA-N |
| XLogP | 6.11 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|