C11H12Cl2 — CID 144910794
2-but-1-en-2-yl-1,3-dichloro-5-methylbenzene (PubChem CID 144910794) has the molecular formula C11H12Cl2 and a molecular weight of 215.12 g/mol. Its IUPAC name is 2-but-1-en-2-yl-1,3-dichloro-5-methylbenzene.
| Compound Name | 2-but-1-en-2-yl-1,3-dichloro-5-methylbenzene |
|---|---|
| PubChem CID | 144910794 |
| Molecular Formula | C11H12Cl2 |
| Molecular Weight | 215.12 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 2-but-1-en-2-yl-1,3-dichloro-5-methylbenzene |
| SMILES | C=C(CC)c1c(Cl)cc(C)cc1Cl |
| InChI | InChI=1S/C11H12Cl2/c1-4-8(3)11-9(12)5-7(2)6-10(11)13/h5-6H,3-4H2,1-2H3 |
| InChIKey | TYXVCTIIQXVJNF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.12 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |