About 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane
1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane (PubChem CID 153404685) has the molecular formula C18H31Cl
and a molecular weight of 282.90 g/mol. Its IUPAC name is 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane.
Molecular Properties
| Compound Name | 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane |
| PubChem CID | 153404685 |
| Molecular Formula | C18H31Cl |
| Molecular Weight | 282.90 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane |
| SMILES | C=C(CC)c1ccc(C)cc1Cl.CC.CCCCC |
| InChI | InChI=1S/C11H13Cl.C5H12.C2H6/c1-4-9(3)10-6-5-8(2)7-11(10)12;1-3-5-4-2;1-2/h5-7H,3-4H2,1-2H3;3-5H2,1-2H3;1-2H3 |
| InChIKey | LIUWUJSLGXRSSF-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 282.90 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane?
The IUPAC name of 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane (CID 153404685) is 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane.
What is the SMILES notation for 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane?
The canonical SMILES for 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane is C=C(CC)c1ccc(C)cc1Cl.CC.CCCCC.
What is the InChIKey of 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane?
The InChIKey is LIUWUJSLGXRSSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13Cl.C5H12.C2H6/c1-4-9(3)10-6-5-8(2)7-11(10)12;1-3-5-4-2;1-2/h5-7H,3-4H2,1-2H3;3-5H2,1-2H3;1-2H3.
What are the key properties of 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane?
1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane has a molecular weight of 282.90 g/mol, XLogP of 7.29, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-1-en-2-yl-2-chloro-4-methylbenzene;ethane;pentane is sourced from PubChem (CID 153404685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).