C13H16O4 — CID 144914519
5-[(2Z)-2-ethenylpenta-2,4-dienyl]-2,2-dimethyl-1,3-dioxane-4,6-dione (PubChem CID 144914519) has the molecular formula C13H16O4 and a molecular weight of 236.27 g/mol. Its IUPAC name is 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-2,2-dimethyl-1,3-dioxane-4,6-dione.
| Compound Name | 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
|---|---|
| PubChem CID | 144914519 |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 5-[(2Z)-2-ethenylpenta-2,4-dienyl]-2,2-dimethyl-1,3-dioxane-4,6-dione |
| SMILES | C=C/C=C(\C=C)CC1C(=O)OC(C)(C)OC1=O |
| InChI | InChI=1S/C13H16O4/c1-5-7-9(6-2)8-10-11(14)16-13(3,4)17-12(10)15/h5-7,10H,1-2,8H2,3-4H3/b9-7+ |
| InChIKey | IJTIGYIZEVBVOT-VQHVLOKHSA-N |
| XLogP | 2.13 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|