C11H21NO — CID 144914692
(4E)-5-amino-2,6-dimethylhepta-2,4,6-trien-3-ol;ethane (PubChem CID 144914692) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (4E)-5-amino-2,6-dimethylhepta-2,4,6-trien-3-ol;ethane.
| Compound Name | (4E)-5-amino-2,6-dimethylhepta-2,4,6-trien-3-ol;ethane |
|---|---|
| PubChem CID | 144914692 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (4E)-5-amino-2,6-dimethylhepta-2,4,6-trien-3-ol;ethane |
| SMILES | C=C(C)/C(N)=C\C(O)=C(C)C.CC |
| InChI | InChI=1S/C9H15NO.C2H6/c1-6(2)8(10)5-9(11)7(3)4;1-2/h5,11H,1,10H2,2-4H3;1-2H3/b8-5+; |
| InChIKey | MJCBXUZZUKLOEZ-HAAWTFQLSA-N |
| XLogP | 3.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|