C52H43N5 — CID 144914970
benzenecarboximidamide;N-benzylmethanimine;23-(3-methylphenyl)-8-phenyl-8,23-diazahexacyclo[13.11.0.02,7.09,14.016,24.017,22]hexacosa-1(15),2,4,6,9,11,13,16(24),17,19,21,25-dodecaene (PubChem CID 144914970) has the molecular formula C52H43N5 and a molecular weight of 737.95 g/mol. Its IUPAC name is benzenecarboximidamide;N-benzylmethanimine;23-(3-methylphenyl)-8-phenyl-8,23-diazahexacyclo[13.11.0.02,7.09,14.016,24.017,22]hexacosa-1(15),2,4,6,9,11,13,16(24),17,19,21,25-dodecaene.
| Compound Name | benzenecarboximidamide;N-benzylmethanimine;23-(3-methylphenyl)-8-phenyl-8,23-diazahexacyclo[13.11.0.02,7.09,14.016,24.017,22]hexacosa-1(15),2,4,6,9,11,13,16(24),17,19,21,25-dodecaene |
|---|---|
| PubChem CID | 144914970 |
| Molecular Formula | C52H43N5 |
| Molecular Weight | 737.95 g/mol |
| Exact Mass | 737.35 |
| IUPAC Name | benzenecarboximidamide;N-benzylmethanimine;23-(3-methylphenyl)-8-phenyl-8,23-diazahexacyclo[13.11.0.02,7.09,14.016,24.017,22]hexacosa-1(15),2,4,6,9,11,13,16(24),17,19,21,25-dodecaene |
| SMILES | C=NCc1ccccc1.Cc1cccc(-n2c3ccccc3c3c4c(ccc32)-c2ccccc2N(c2ccccc2)c2ccccc2-4)c1.[H]/N=C(\N)c1ccccc1 |
| InChI | InChI=1S/C37H26N2.C8H9N.C7H8N2/c1-25-12-11-15-27(24-25)39-34-21-10-7-18-31(34)37-35(39)23-22-29-28-16-5-8-19-32(28)38(26-13-3-2-4-14-26)33-20-9-6-17-30(33)36(29)37;1-9-7-8-5-3-2-4-6-8;8-7(9)6-4-2-1-3-5-6/h2-24H,1H3;2-6H,1,7H2;1-5H,(H3,8,9) |
| InChIKey | AEDCKYZYNJGYHX-UHFFFAOYSA-N |
| XLogP | 13.07 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.95 |
| LogP ≤ 5 | 13.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|