C25H30O4 — CID 144917978
7-[(3S)-3-hydroxy-4,4,8a-trimethyl-7-methylidenespiro[1,2,3,4a,5,6-hexahydronaphthalene-8,2'-cyclopropane]-1'-yl]oxychromen-2-one (PubChem CID 144917978) has the molecular formula C25H30O4 and a molecular weight of 394.51 g/mol. Its IUPAC name is 7-[(3S)-3-hydroxy-4,4,8a-trimethyl-7-methylidenespiro[1,2,3,4a,5,6-hexahydronaphthalene-8,2'-cyclopropane]-1'-yl]oxychromen-2-one.
| Compound Name | 7-[(3S)-3-hydroxy-4,4,8a-trimethyl-7-methylidenespiro[1,2,3,4a,5,6-hexahydronaphthalene-8,2'-cyclopropane]-1'-yl]oxychromen-2-one |
|---|---|
| PubChem CID | 144917978 |
| Molecular Formula | C25H30O4 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.21 |
| IUPAC Name | 7-[(3S)-3-hydroxy-4,4,8a-trimethyl-7-methylidenespiro[1,2,3,4a,5,6-hexahydronaphthalene-8,2'-cyclopropane]-1'-yl]oxychromen-2-one |
| SMILES | C=C1CCC2C(C)(C)[C@@H](O)CCC2(C)C12CC2Oc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C25H30O4/c1-15-5-9-19-23(2,3)20(26)11-12-24(19,4)25(15)14-21(25)28-17-8-6-16-7-10-22(27)29-18(16)13-17/h6-8,10,13,19-21,26H,1,5,9,11-12,14H2,2-4H3/t19?,20-,21?,24?,25?/m0/s1 |
| InChIKey | DHKRLPKJKKJYMX-BACOMELUSA-N |
| XLogP | 5.08 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|