C54H43N5 — CID 144918497
N-[(2E,4Z)-hepta-2,4-dien-3-yl]-N,2-diphenyl-6-[3-(5-phenyl-6H-cyclohepta[b]indol-2-yl)carbazol-9-yl]pyrimidin-4-amine (PubChem CID 144918497) has the molecular formula C54H43N5 and a molecular weight of 761.97 g/mol. Its IUPAC name is N-[(2E,4Z)-hepta-2,4-dien-3-yl]-N,2-diphenyl-6-[3-(5-phenyl-6H-cyclohepta[b]indol-2-yl)carbazol-9-yl]pyrimidin-4-amine.
| Compound Name | N-[(2E,4Z)-hepta-2,4-dien-3-yl]-N,2-diphenyl-6-[3-(5-phenyl-6H-cyclohepta[b]indol-2-yl)carbazol-9-yl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 144918497 |
| Molecular Formula | C54H43N5 |
| Molecular Weight | 761.97 g/mol |
| Exact Mass | 761.35 |
| IUPAC Name | N-[(2E,4Z)-hepta-2,4-dien-3-yl]-N,2-diphenyl-6-[3-(5-phenyl-6H-cyclohepta[b]indol-2-yl)carbazol-9-yl]pyrimidin-4-amine |
| SMILES | C/C=C(\C=C/CC)N(c1ccccc1)c1cc(-n2c3ccccc3c3cc(-c4ccc5c(c4)c4c(n5-c5ccccc5)CC=CC=C4)ccc32)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C54H43N5/c1-3-5-22-41(4-2)57(42-23-12-7-13-24-42)52-37-53(56-54(55-52)38-20-10-6-11-21-38)59-49-30-19-18-28-45(49)47-36-40(32-34-51(47)59)39-31-33-50-46(35-39)44-27-16-9-17-29-48(44)58(50)43-25-14-8-15-26-43/h4-28,30-37H,3,29H2,1-2H3/b22-5-,41-4+ |
| InChIKey | NGBMPTFOSKNFKM-ZMPFFYAWSA-N |
| XLogP | 13.99 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.97 |
| LogP ≤ 5 | 13.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|