C15H16N6O3S3 — CID 144922039
N-[5-[2-[2-(5-formamido-1,3,4-thiadiazol-2-yl)ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2-(furan-2-yl)acetamide (PubChem CID 144922039) has the molecular formula C15H16N6O3S3 and a molecular weight of 424.53 g/mol. Its IUPAC name is N-[5-[2-[2-(5-formamido-1,3,4-thiadiazol-2-yl)ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2-(furan-2-yl)acetamide.
| Compound Name | N-[5-[2-[2-(5-formamido-1,3,4-thiadiazol-2-yl)ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2-(furan-2-yl)acetamide |
|---|---|
| PubChem CID | 144922039 |
| Molecular Formula | C15H16N6O3S3 |
| Molecular Weight | 424.53 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | N-[5-[2-[2-(5-formamido-1,3,4-thiadiazol-2-yl)ethylsulfanyl]ethyl]-1,3,4-thiadiazol-2-yl]-2-(furan-2-yl)acetamide |
| SMILES | O=CNc1nnc(CCSCCc2nnc(NC(=O)Cc3ccco3)s2)s1 |
| InChI | InChI=1S/C15H16N6O3S3/c22-9-16-14-20-18-12(26-14)3-6-25-7-4-13-19-21-15(27-13)17-11(23)8-10-2-1-5-24-10/h1-2,5,9H,3-4,6-8H2,(H,16,20,22)(H,17,21,23) |
| InChIKey | VQFTXNKENYRALW-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 122.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.53 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|