C36H57FN2 — CID 144923978
N-[4-[(Z)-1-(4-fluoro-2-methylphenyl)pent-1-enyl]-2-methylphenyl]-3-methylheptan-4-imine;N-methyl-N-propylpentan-1-amine (PubChem CID 144923978) has the molecular formula C36H57FN2 and a molecular weight of 536.86 g/mol. Its IUPAC name is N-[4-[(Z)-1-(4-fluoro-2-methylphenyl)pent-1-enyl]-2-methylphenyl]-3-methylheptan-4-imine;N-methyl-N-propylpentan-1-amine.
| Compound Name | N-[4-[(Z)-1-(4-fluoro-2-methylphenyl)pent-1-enyl]-2-methylphenyl]-3-methylheptan-4-imine;N-methyl-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 144923978 |
| Molecular Formula | C36H57FN2 |
| Molecular Weight | 536.86 g/mol |
| Exact Mass | 536.45 |
| IUPAC Name | N-[4-[(Z)-1-(4-fluoro-2-methylphenyl)pent-1-enyl]-2-methylphenyl]-3-methylheptan-4-imine;N-methyl-N-propylpentan-1-amine |
| SMILES | CCC/C=C(/c1ccc(/N=C(\CCC)C(C)CC)c(C)c1)c1ccc(F)cc1C.CCCCCN(C)CCC |
| InChI | InChI=1S/C27H36FN.C9H21N/c1-7-10-12-25(24-15-14-23(28)18-20(24)5)22-13-16-27(21(6)17-22)29-26(11-8-2)19(4)9-3;1-4-6-7-9-10(3)8-5-2/h12-19H,7-11H2,1-6H3;4-9H2,1-3H3/b25-12-,29-26+; |
| InChIKey | XIZNCAIJNGXJTJ-XSXFKWRGSA-N |
| XLogP | 11.11 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.86 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|