C20H21FN2S — CID 144924060
N-[4-(6-fluoro-1H-indol-3-yl)-2-methylphenyl]-2-methylbutanethioamide (PubChem CID 144924060) has the molecular formula C20H21FN2S and a molecular weight of 340.47 g/mol. Its IUPAC name is N-[4-(6-fluoro-1H-indol-3-yl)-2-methylphenyl]-2-methylbutanethioamide.
| Compound Name | N-[4-(6-fluoro-1H-indol-3-yl)-2-methylphenyl]-2-methylbutanethioamide |
|---|---|
| PubChem CID | 144924060 |
| Molecular Formula | C20H21FN2S |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-[4-(6-fluoro-1H-indol-3-yl)-2-methylphenyl]-2-methylbutanethioamide |
| SMILES | CCC(C)C(=S)Nc1ccc(-c2c[nH]c3cc(F)ccc23)cc1C |
| InChI | InChI=1S/C20H21FN2S/c1-4-12(2)20(24)23-18-8-5-14(9-13(18)3)17-11-22-19-10-15(21)6-7-16(17)19/h5-12,22H,4H2,1-3H3,(H,23,24) |
| InChIKey | ARAFSXMSPPPYAQ-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|