C27H26N4O — CID 14492475
4,6-diphenyl-2-[(4-phenylpiperazin-1-yl)methyl]pyridazin-3-one (PubChem CID 14492475) has the molecular formula C27H26N4O and a molecular weight of 422.53 g/mol. Its IUPAC name is 4,6-diphenyl-2-[(4-phenylpiperazin-1-yl)methyl]pyridazin-3-one.
| Compound Name | 4,6-diphenyl-2-[(4-phenylpiperazin-1-yl)methyl]pyridazin-3-one |
|---|---|
| PubChem CID | 14492475 |
| Molecular Formula | C27H26N4O |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 4,6-diphenyl-2-[(4-phenylpiperazin-1-yl)methyl]pyridazin-3-one |
| SMILES | O=c1c(-c2ccccc2)cc(-c2ccccc2)nn1CN1CCN(c2ccccc2)CC1 |
| InChI | InChI=1S/C27H26N4O/c32-27-25(22-10-4-1-5-11-22)20-26(23-12-6-2-7-13-23)28-31(27)21-29-16-18-30(19-17-29)24-14-8-3-9-15-24/h1-15,20H,16-19,21H2 |
| InChIKey | ZZJIDHTXIRNVHY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |