C40H26N4 — CID 144924911
2-[4-[7-[4-[(2E,4Z)-5-amino-2-cyanopenta-2,4-dienyl]phenyl]pyren-2-yl]phenyl]pyridine-3-carbonitrile (PubChem CID 144924911) has the molecular formula C40H26N4 and a molecular weight of 562.68 g/mol. Its IUPAC name is 2-[4-[7-[4-[(2E,4Z)-5-amino-2-cyanopenta-2,4-dienyl]phenyl]pyren-2-yl]phenyl]pyridine-3-carbonitrile.
| Compound Name | 2-[4-[7-[4-[(2E,4Z)-5-amino-2-cyanopenta-2,4-dienyl]phenyl]pyren-2-yl]phenyl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 144924911 |
| Molecular Formula | C40H26N4 |
| Molecular Weight | 562.68 g/mol |
| Exact Mass | 562.22 |
| IUPAC Name | 2-[4-[7-[4-[(2E,4Z)-5-amino-2-cyanopenta-2,4-dienyl]phenyl]pyren-2-yl]phenyl]pyridine-3-carbonitrile |
| SMILES | N#C/C(=C/C=C\N)Cc1ccc(-c2cc3ccc4cc(-c5ccc(-c6ncccc6C#N)cc5)cc5ccc(c2)c3c45)cc1 |
| InChI | InChI=1S/C40H26N4/c41-17-1-3-27(24-42)19-26-5-7-28(8-6-26)36-20-31-13-15-33-22-37(23-34-16-14-32(21-36)38(31)39(33)34)29-9-11-30(12-10-29)40-35(25-43)4-2-18-44-40/h1-18,20-23H,19,41H2/b17-1-,27-3+ |
| InChIKey | RWCJISDIMMGNCS-ABOMMTJSSA-N |
| XLogP | 9.32 |
| TPSA | 86.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.68 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|