C26H25N3S — CID 144927700
1-methyl-4-[5-(6-piperidin-1-ylnaphthalen-2-yl)thiophen-2-yl]-2H-pyridine-3-carbonitrile (PubChem CID 144927700) has the molecular formula C26H25N3S and a molecular weight of 411.57 g/mol. Its IUPAC name is 1-methyl-4-[5-(6-piperidin-1-ylnaphthalen-2-yl)thiophen-2-yl]-2H-pyridine-3-carbonitrile.
| Compound Name | 1-methyl-4-[5-(6-piperidin-1-ylnaphthalen-2-yl)thiophen-2-yl]-2H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 144927700 |
| Molecular Formula | C26H25N3S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-methyl-4-[5-(6-piperidin-1-ylnaphthalen-2-yl)thiophen-2-yl]-2H-pyridine-3-carbonitrile |
| SMILES | CN1C=CC(c2ccc(-c3ccc4cc(N5CCCCC5)ccc4c3)s2)=C(C#N)C1 |
| InChI | InChI=1S/C26H25N3S/c1-28-14-11-24(22(17-27)18-28)26-10-9-25(30-26)21-6-5-20-16-23(8-7-19(20)15-21)29-12-3-2-4-13-29/h5-11,14-16H,2-4,12-13,18H2,1H3 |
| InChIKey | DVVUYXRGHIANSO-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |