C20H27N3O — CID 144928520
N-[(3Z)-5-cyclohexyl-5-methyliminopenta-1,3-dien-2-yl]-3-pyridin-2-ylpropanamide (PubChem CID 144928520) has the molecular formula C20H27N3O and a molecular weight of 325.46 g/mol. Its IUPAC name is N-[(3Z)-5-cyclohexyl-5-methyliminopenta-1,3-dien-2-yl]-3-pyridin-2-ylpropanamide.
| Compound Name | N-[(3Z)-5-cyclohexyl-5-methyliminopenta-1,3-dien-2-yl]-3-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 144928520 |
| Molecular Formula | C20H27N3O |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.22 |
| IUPAC Name | N-[(3Z)-5-cyclohexyl-5-methyliminopenta-1,3-dien-2-yl]-3-pyridin-2-ylpropanamide |
| SMILES | C=C(/C=C\C(=N\C)C1CCCCC1)NC(=O)CCc1ccccn1 |
| InChI | InChI=1S/C20H27N3O/c1-16(11-13-19(21-2)17-8-4-3-5-9-17)23-20(24)14-12-18-10-6-7-15-22-18/h6-7,10-11,13,15,17H,1,3-5,8-9,12,14H2,2H3,(H,23,24)/b13-11-,21-19- |
| InChIKey | BOXHULPVDRGESW-ZPIUPWHUSA-N |
| XLogP | 3.85 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|