C15H21N3 — CID 143316373
N',3-dimethyl-N-(4-pyridin-2-ylbut-1-en-2-yl)but-2-enimidamide (PubChem CID 143316373) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is N',3-dimethyl-N-(4-pyridin-2-ylbut-1-en-2-yl)but-2-enimidamide.
| Compound Name | N',3-dimethyl-N-(4-pyridin-2-ylbut-1-en-2-yl)but-2-enimidamide |
|---|---|
| PubChem CID | 143316373 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | N',3-dimethyl-N-(4-pyridin-2-ylbut-1-en-2-yl)but-2-enimidamide |
| SMILES | C=C(CCc1ccccn1)N/C(C=C(C)C)=N/C |
| InChI | InChI=1S/C15H21N3/c1-12(2)11-15(16-4)18-13(3)8-9-14-7-5-6-10-17-14/h5-7,10-11H,3,8-9H2,1-2,4H3,(H,16,18) |
| InChIKey | KJYJGJKMOBJIAT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|