C20H23N3 — CID 166797996
(3E)-N-prop-1-en-2-yl-4-[6-(2-pyridin-2-ylethyl)-3-pyridinyl]penta-1,3-dien-2-amine (PubChem CID 166797996) has the molecular formula C20H23N3 and a molecular weight of 305.43 g/mol. Its IUPAC name is (3E)-N-prop-1-en-2-yl-4-[6-(2-pyridin-2-ylethyl)-3-pyridinyl]penta-1,3-dien-2-amine.
| Compound Name | (3E)-N-prop-1-en-2-yl-4-[6-(2-pyridin-2-ylethyl)-3-pyridinyl]penta-1,3-dien-2-amine |
|---|---|
| PubChem CID | 166797996 |
| Molecular Formula | C20H23N3 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | (3E)-N-prop-1-en-2-yl-4-[6-(2-pyridin-2-ylethyl)-3-pyridinyl]penta-1,3-dien-2-amine |
| SMILES | C=C(C)NC(=C)/C=C(\C)c1ccc(CCc2ccccn2)nc1 |
| InChI | InChI=1S/C20H23N3/c1-15(2)23-17(4)13-16(3)18-8-9-20(22-14-18)11-10-19-7-5-6-12-21-19/h5-9,12-14,23H,1,4,10-11H2,2-3H3/b16-13+ |
| InChIKey | XJOXPNNRIHUONE-DTQAZKPQSA-N |
| XLogP | 4.30 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|