C34H35N — CID 144930884
ethane;3-methyl-1-phenylisoquinoline;3,9,9-trimethylfluorene (PubChem CID 144930884) has the molecular formula C34H35N and a molecular weight of 457.66 g/mol. Its IUPAC name is ethane;3-methyl-1-phenylisoquinoline;3,9,9-trimethylfluorene.
| Compound Name | ethane;3-methyl-1-phenylisoquinoline;3,9,9-trimethylfluorene |
|---|---|
| PubChem CID | 144930884 |
| Molecular Formula | C34H35N |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | ethane;3-methyl-1-phenylisoquinoline;3,9,9-trimethylfluorene |
| SMILES | CC.Cc1cc2ccccc2c(-c2ccccc2)n1.Cc1ccc2c(c1)-c1ccccc1C2(C)C |
| InChI | InChI=1S/C16H13N.C16H16.C2H6/c1-12-11-14-9-5-6-10-15(14)16(17-12)13-7-3-2-4-8-13;1-11-8-9-15-13(10-11)12-6-4-5-7-14(12)16(15,2)3;1-2/h2-11H,1H3;4-10H,1-3H3;1-2H3 |
| InChIKey | MDZHJAGYPIDNIU-UHFFFAOYSA-N |
| XLogP | 9.54 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 9.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |