C29H33NO2S — CID 144931913
2-[(6S)-1,4-dimethyl-2-(4-methylphenyl)-6-(2-methylpropyl)-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid (PubChem CID 144931913) has the molecular formula C29H33NO2S and a molecular weight of 459.66 g/mol. Its IUPAC name is 2-[(6S)-1,4-dimethyl-2-(4-methylphenyl)-6-(2-methylpropyl)-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid.
| Compound Name | 2-[(6S)-1,4-dimethyl-2-(4-methylphenyl)-6-(2-methylpropyl)-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 144931913 |
| Molecular Formula | C29H33NO2S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | 2-[(6S)-1,4-dimethyl-2-(4-methylphenyl)-6-(2-methylpropyl)-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid |
| SMILES | CSN1c2c(C)c(CC(=O)O)c(-c3ccc(C)cc3)c(C)c2-c2ccccc2[C@@H]1CC(C)C |
| InChI | InChI=1S/C29H33NO2S/c1-17(2)15-25-22-9-7-8-10-23(22)28-20(5)27(21-13-11-18(3)12-14-21)24(16-26(31)32)19(4)29(28)30(25)33-6/h7-14,17,25H,15-16H2,1-6H3,(H,31,32)/t25-/m0/s1 |
| InChIKey | MXGBJKRPSQEAPD-VWLOTQADSA-N |
| XLogP | 7.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|