C35H37NO3S — CID 144931935
2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-9-(4-phenylbutoxy)-6H-phenanthridin-3-yl]acetic acid (PubChem CID 144931935) has the molecular formula C35H37NO3S and a molecular weight of 551.75 g/mol. Its IUPAC name is 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-9-(4-phenylbutoxy)-6H-phenanthridin-3-yl]acetic acid.
| Compound Name | 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-9-(4-phenylbutoxy)-6H-phenanthridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 144931935 |
| Molecular Formula | C35H37NO3S |
| Molecular Weight | 551.75 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-9-(4-phenylbutoxy)-6H-phenanthridin-3-yl]acetic acid |
| SMILES | CSN1Cc2ccc(OCCCCc3ccccc3)cc2-c2c(C)c(-c3ccc(C)cc3)c(CC(=O)O)c(C)c21 |
| InChI | InChI=1S/C35H37NO3S/c1-23-13-15-27(16-14-23)33-25(3)34-31-20-29(39-19-9-8-12-26-10-6-5-7-11-26)18-17-28(31)22-36(40-4)35(34)24(2)30(33)21-32(37)38/h5-7,10-11,13-18,20H,8-9,12,19,21-22H2,1-4H3,(H,37,38) |
| InChIKey | HGZWZXJZLFAWFX-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.75 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|