C32H31NO3S — CID 144931484
2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfinyl-8-phenylmethoxy-6H-phenanthridin-3-yl]acetaldehyde (PubChem CID 144931484) has the molecular formula C32H31NO3S and a molecular weight of 509.67 g/mol. Its IUPAC name is 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfinyl-8-phenylmethoxy-6H-phenanthridin-3-yl]acetaldehyde.
| Compound Name | 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfinyl-8-phenylmethoxy-6H-phenanthridin-3-yl]acetaldehyde |
|---|---|
| PubChem CID | 144931484 |
| Molecular Formula | C32H31NO3S |
| Molecular Weight | 509.67 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfinyl-8-phenylmethoxy-6H-phenanthridin-3-yl]acetaldehyde |
| SMILES | Cc1ccc(-c2c(C)c3c(c(C)c2CC=O)N(S(C)=O)Cc2cc(OCc4ccccc4)ccc2-3)cc1 |
| InChI | InChI=1S/C32H31NO3S/c1-21-10-12-25(13-11-21)30-23(3)31-29-15-14-27(36-20-24-8-6-5-7-9-24)18-26(29)19-33(37(4)35)32(31)22(2)28(30)16-17-34/h5-15,17-18H,16,19-20H2,1-4H3 |
| InChIKey | FETQRTBBUWWDSO-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.67 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|