C32H43NO3S — CID 144932178
2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid;2-methylpropan-2-ol;propane (PubChem CID 144932178) has the molecular formula C32H43NO3S and a molecular weight of 521.77 g/mol. Its IUPAC name is 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid;2-methylpropan-2-ol;propane.
| Compound Name | 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid;2-methylpropan-2-ol;propane |
|---|---|
| PubChem CID | 144932178 |
| Molecular Formula | C32H43NO3S |
| Molecular Weight | 521.77 g/mol |
| Exact Mass | 521.30 |
| IUPAC Name | 2-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid;2-methylpropan-2-ol;propane |
| SMILES | CC(C)(C)O.CCC.CSN1Cc2ccccc2-c2c(C)c(-c3ccc(C)cc3)c(CC(=O)O)c(C)c21 |
| InChI | InChI=1S/C25H25NO2S.C4H10O.C3H8/c1-15-9-11-18(12-10-15)23-17(3)24-20-8-6-5-7-19(20)14-26(29-4)25(24)16(2)21(23)13-22(27)28;1-4(2,3)5;1-3-2/h5-12H,13-14H2,1-4H3,(H,27,28);5H,1-3H3;3H2,1-2H3 |
| InChIKey | KPIINSFIUQMDRB-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.77 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|