C28H25ClN4O3S — CID 144931593
2-[2-(4-chlorophenyl)-8-(1H-imidazole-2-carbonylamino)-1,4-dimethyl-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid (PubChem CID 144931593) has the molecular formula C28H25ClN4O3S and a molecular weight of 533.05 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-8-(1H-imidazole-2-carbonylamino)-1,4-dimethyl-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid.
| Compound Name | 2-[2-(4-chlorophenyl)-8-(1H-imidazole-2-carbonylamino)-1,4-dimethyl-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid |
|---|---|
| PubChem CID | 144931593 |
| Molecular Formula | C28H25ClN4O3S |
| Molecular Weight | 533.05 g/mol |
| Exact Mass | 532.13 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-8-(1H-imidazole-2-carbonylamino)-1,4-dimethyl-5-methylsulfanyl-6H-phenanthridin-3-yl]acetic acid |
| SMILES | CSN1Cc2cc(NC(=O)c3ncc[nH]3)ccc2-c2c(C)c(-c3ccc(Cl)cc3)c(CC(=O)O)c(C)c21 |
| InChI | InChI=1S/C28H25ClN4O3S/c1-15-22(13-23(34)35)24(17-4-6-19(29)7-5-17)16(2)25-21-9-8-20(32-28(36)27-30-10-11-31-27)12-18(21)14-33(37-3)26(15)25/h4-12H,13-14H2,1-3H3,(H,30,31)(H,32,36)(H,34,35) |
| InChIKey | QRURHZDNOFJTCS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 98.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.05 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|