C42H54N4O4S — CID 144931970
N-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-3-(2-oxoethyl)-6H-phenanthridin-9-yl]-2-(4-methylpiperazin-1-yl)benzamide;methanol;2-methylpropan-2-ol (PubChem CID 144931970) has the molecular formula C42H54N4O4S and a molecular weight of 710.99 g/mol. Its IUPAC name is N-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-3-(2-oxoethyl)-6H-phenanthridin-9-yl]-2-(4-methylpiperazin-1-yl)benzamide;methanol;2-methylpropan-2-ol.
| Compound Name | N-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-3-(2-oxoethyl)-6H-phenanthridin-9-yl]-2-(4-methylpiperazin-1-yl)benzamide;methanol;2-methylpropan-2-ol |
|---|---|
| PubChem CID | 144931970 |
| Molecular Formula | C42H54N4O4S |
| Molecular Weight | 710.99 g/mol |
| Exact Mass | 710.39 |
| IUPAC Name | N-[1,4-dimethyl-2-(4-methylphenyl)-5-methylsulfanyl-3-(2-oxoethyl)-6H-phenanthridin-9-yl]-2-(4-methylpiperazin-1-yl)benzamide;methanol;2-methylpropan-2-ol |
| SMILES | CC(C)(C)O.CO.CSN1Cc2ccc(NC(=O)c3ccccc3N3CCN(C)CC3)cc2-c2c(C)c(-c3ccc(C)cc3)c(CC=O)c(C)c21 |
| InChI | InChI=1S/C37H40N4O2S.C4H10O.CH4O/c1-24-10-12-27(13-11-24)34-26(3)35-32-22-29(15-14-28(32)23-41(44-5)36(35)25(2)30(34)16-21-42)38-37(43)31-8-6-7-9-33(31)40-19-17-39(4)18-20-40;1-4(2,3)5;1-2/h6-15,21-22H,16-20,23H2,1-5H3,(H,38,43);5H,1-3H3;2H,1H3 |
| InChIKey | DKPAUVCPPLLWPO-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 96.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.99 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|