C18H19BrF3NO4 — CID 144932627
N-[3-bromo-2-[[5-methyl-2-(trifluoromethyl)phenoxy]methyl]phenyl]-N-methylhydroxylamine;methyl formate (PubChem CID 144932627) has the molecular formula C18H19BrF3NO4 and a molecular weight of 450.25 g/mol. Its IUPAC name is N-[3-bromo-2-[[5-methyl-2-(trifluoromethyl)phenoxy]methyl]phenyl]-N-methylhydroxylamine;methyl formate.
| Compound Name | N-[3-bromo-2-[[5-methyl-2-(trifluoromethyl)phenoxy]methyl]phenyl]-N-methylhydroxylamine;methyl formate |
|---|---|
| PubChem CID | 144932627 |
| Molecular Formula | C18H19BrF3NO4 |
| Molecular Weight | 450.25 g/mol |
| Exact Mass | 449.04 |
| IUPAC Name | N-[3-bromo-2-[[5-methyl-2-(trifluoromethyl)phenoxy]methyl]phenyl]-N-methylhydroxylamine;methyl formate |
| SMILES | COC=O.Cc1ccc(C(F)(F)F)c(OCc2c(Br)cccc2N(C)O)c1 |
| InChI | InChI=1S/C16H15BrF3NO2.C2H4O2/c1-10-6-7-12(16(18,19)20)15(8-10)23-9-11-13(17)4-3-5-14(11)21(2)22;1-4-2-3/h3-8,22H,9H2,1-2H3;2H,1H3 |
| InChIKey | GQFMYZDAOGWTHP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.25 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|