C19H25NO4S — CID 144933812
N-[3-ethyl-2-[(2-methyl-4-sulfanylphenoxy)methyl]phenyl]-N-methylhydroxylamine;methyl formate (PubChem CID 144933812) has the molecular formula C19H25NO4S and a molecular weight of 363.48 g/mol. Its IUPAC name is N-[3-ethyl-2-[(2-methyl-4-sulfanylphenoxy)methyl]phenyl]-N-methylhydroxylamine;methyl formate.
| Compound Name | N-[3-ethyl-2-[(2-methyl-4-sulfanylphenoxy)methyl]phenyl]-N-methylhydroxylamine;methyl formate |
|---|---|
| PubChem CID | 144933812 |
| Molecular Formula | C19H25NO4S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | N-[3-ethyl-2-[(2-methyl-4-sulfanylphenoxy)methyl]phenyl]-N-methylhydroxylamine;methyl formate |
| SMILES | CCc1cccc(N(C)O)c1COc1ccc(S)cc1C.COC=O |
| InChI | InChI=1S/C17H21NO2S.C2H4O2/c1-4-13-6-5-7-16(18(3)19)15(13)11-20-17-9-8-14(21)10-12(17)2;1-4-2-3/h5-10,19,21H,4,11H2,1-3H3;2H,1H3 |
| InChIKey | SJWVKWCDLRKYLG-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|