C14H13NO — CID 144936641
1-[(2E,4E,6E)-9-methyl-1-benzazocin-3-yl]ethanone (PubChem CID 144936641) has the molecular formula C14H13NO and a molecular weight of 211.26 g/mol. Its IUPAC name is 1-[(2E,4E,6E)-9-methyl-1-benzazocin-3-yl]ethanone.
| Compound Name | 1-[(2E,4E,6E)-9-methyl-1-benzazocin-3-yl]ethanone |
|---|---|
| PubChem CID | 144936641 |
| Molecular Formula | C14H13NO |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 1-[(2E,4E,6E)-9-methyl-1-benzazocin-3-yl]ethanone |
| SMILES | CC(=O)C1=C/N=c2/cc(C)cc/c2=C/C=C\1 |
| InChI | InChI=1S/C14H13NO/c1-10-6-7-12-4-3-5-13(11(2)16)9-15-14(12)8-10/h3-9H,1-2H3/b4-3-,5-3-,12-4-,13-5+,13-9+,15-9-,15-14- |
| InChIKey | SZZCFPMCHHOSJU-DTPKZTNDSA-N |
| XLogP | 1.44 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |