About 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine
1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine (PubChem CID 144940225) has the molecular formula C29H32FN
and a molecular weight of 413.58 g/mol. Its IUPAC name is 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine.
Molecular Properties
| Compound Name | 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine |
| PubChem CID | 144940225 |
| Molecular Formula | C29H32FN |
| Molecular Weight | 413.58 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine |
| SMILES | CC.CCc1ccc(-c2ccncc2)cc1.FCc1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C14H13F.C13H13N.C2H6/c15-11-14-9-5-4-8-13(14)10-12-6-2-1-3-7-12;1-2-11-3-5-12(6-4-11)13-7-9-14-10-8-13;1-2/h1-9H,10-11H2;3-10H,2H2,1H3;1-2H3 |
| InChIKey | VUCHZXARQLSJQZ-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 413.58 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine?
The IUPAC name of 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine (CID 144940225) is 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine.
What is the SMILES notation for 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine?
The canonical SMILES for 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine is CC.CCc1ccc(-c2ccncc2)cc1.FCc1ccccc1Cc1ccccc1.
What is the InChIKey of 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine?
The InChIKey is VUCHZXARQLSJQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F.C13H13N.C2H6/c15-11-14-9-5-4-8-13(14)10-12-6-2-1-3-7-12;1-2-11-3-5-12(6-4-11)13-7-9-14-10-8-13;1-2/h1-9H,10-11H2;3-10H,2H2,1H3;1-2H3.
What are the key properties of 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine?
1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine has a molecular weight of 413.58 g/mol, XLogP of 8.08, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-2-(fluoromethyl)benzene;ethane;4-(4-ethylphenyl)pyridine is sourced from PubChem (CID 144940225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).