C21H18F6N4O3 — CID 144942829
N-[3-[(4R,5R,6S)-2-amino-4-ethenyl-6-(fluoromethyl)-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 144942829) has the molecular formula C21H18F6N4O3 and a molecular weight of 488.39 g/mol. Its IUPAC name is N-[3-[(4R,5R,6S)-2-amino-4-ethenyl-6-(fluoromethyl)-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[3-[(4R,5R,6S)-2-amino-4-ethenyl-6-(fluoromethyl)-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 144942829 |
| Molecular Formula | C21H18F6N4O3 |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | N-[3-[(4R,5R,6S)-2-amino-4-ethenyl-6-(fluoromethyl)-5-(2,2,2-trifluoroethoxy)-5,6-dihydro-1,3-oxazin-4-yl]-4-fluorophenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C=C[C@]1(c2cc(NC(=O)c3ccc(F)cn3)ccc2F)N=C(N)O[C@H](CF)[C@@H]1OCC(F)(F)F |
| InChI | InChI=1S/C21H18F6N4O3/c1-2-20(17(33-10-21(25,26)27)16(8-22)34-19(28)31-20)13-7-12(4-5-14(13)24)30-18(32)15-6-3-11(23)9-29-15/h2-7,9,16-17H,1,8,10H2,(H2,28,31)(H,30,32)/t16-,17+,20-/m1/s1 |
| InChIKey | XKUMHVGUCDZSHH-FUHIMQAGSA-N |
| XLogP | 3.62 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|