C19H16N4S — CID 144943671
3-(3-imidazo[1,2-a]pyridin-6-yl-2-pyridinyl)-N-methylsulfanylaniline (PubChem CID 144943671) has the molecular formula C19H16N4S and a molecular weight of 332.43 g/mol. Its IUPAC name is 3-(3-imidazo[1,2-a]pyridin-6-yl-2-pyridinyl)-N-methylsulfanylaniline.
| Compound Name | 3-(3-imidazo[1,2-a]pyridin-6-yl-2-pyridinyl)-N-methylsulfanylaniline |
|---|---|
| PubChem CID | 144943671 |
| Molecular Formula | C19H16N4S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 3-(3-imidazo[1,2-a]pyridin-6-yl-2-pyridinyl)-N-methylsulfanylaniline |
| SMILES | CSNc1cccc(-c2ncccc2-c2ccc3nccn3c2)c1 |
| InChI | InChI=1S/C19H16N4S/c1-24-22-16-5-2-4-14(12-16)19-17(6-3-9-21-19)15-7-8-18-20-10-11-23(18)13-15/h2-13,22H,1H3 |
| InChIKey | MPLUKGANYSTANV-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|