C19H18N2 — CID 167089405
6-[2-methyl-3-[(1E,3E)-penta-1,3-dienyl]phenyl]imidazo[1,2-a]pyridine (PubChem CID 167089405) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is 6-[2-methyl-3-[(1E,3E)-penta-1,3-dienyl]phenyl]imidazo[1,2-a]pyridine.
| Compound Name | 6-[2-methyl-3-[(1E,3E)-penta-1,3-dienyl]phenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 167089405 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 6-[2-methyl-3-[(1E,3E)-penta-1,3-dienyl]phenyl]imidazo[1,2-a]pyridine |
| SMILES | C/C=C/C=C/c1cccc(-c2ccc3nccn3c2)c1C |
| InChI | InChI=1S/C19H18N2/c1-3-4-5-7-16-8-6-9-18(15(16)2)17-10-11-19-20-12-13-21(19)14-17/h3-14H,1-2H3/b4-3+,7-5+ |
| InChIKey | KNBFJSQIOWKNKR-BDWKERMESA-N |
| XLogP | 4.90 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|