About 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine
6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine (PubChem CID 150218840) has the molecular formula C16H16N2O3
and a molecular weight of 284.32 g/mol. Its IUPAC name is 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine.
Molecular Properties
| Compound Name | 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine |
| PubChem CID | 150218840 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine |
| SMILES | COc1cc(-c2ccc3nccn3c2)cc(OC)c1OC |
| InChI | InChI=1S/C16H16N2O3/c1-19-13-8-12(9-14(20-2)16(13)21-3)11-4-5-15-17-6-7-18(15)10-11/h4-10H,1-3H3 |
| InChIKey | FTAWETITGMVBRO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine?
The IUPAC name of 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine (CID 150218840) is 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine.
What is the SMILES notation for 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine?
The canonical SMILES for 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine is COc1cc(-c2ccc3nccn3c2)cc(OC)c1OC.
What is the InChIKey of 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine?
The InChIKey is FTAWETITGMVBRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16N2O3/c1-19-13-8-12(9-14(20-2)16(13)21-3)11-4-5-15-17-6-7-18(15)10-11/h4-10H,1-3H3.
What are the key properties of 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine?
6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine has a molecular weight of 284.32 g/mol, XLogP of 3.03, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine is sourced from PubChem (CID 150218840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).