C16H16N2O3 — CID 150218840
6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine (PubChem CID 150218840) has the molecular formula C16H16N2O3 and a molecular weight of 284.32 g/mol. Its IUPAC name is 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine.
| Compound Name | 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 150218840 |
| Molecular Formula | C16H16N2O3 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 6-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridine |
| SMILES | COc1cc(-c2ccc3nccn3c2)cc(OC)c1OC |
| InChI | InChI=1S/C16H16N2O3/c1-19-13-8-12(9-14(20-2)16(13)21-3)11-4-5-15-17-6-7-18(15)10-11/h4-10H,1-3H3 |
| InChIKey | FTAWETITGMVBRO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 44.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |