C16H15N3O3S — CID 13171497
2-pyridin-4-yl-5-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazole (PubChem CID 13171497) has the molecular formula C16H15N3O3S and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-pyridin-4-yl-5-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-pyridin-4-yl-5-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 13171497 |
| Molecular Formula | C16H15N3O3S |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.08 |
| IUPAC Name | 2-pyridin-4-yl-5-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazole |
| SMILES | COc1cc(-c2nnc(-c3ccncc3)s2)cc(OC)c1OC |
| InChI | InChI=1S/C16H15N3O3S/c1-20-12-8-11(9-13(21-2)14(12)22-3)16-19-18-15(23-16)10-4-6-17-7-5-10/h4-9H,1-3H3 |
| InChIKey | XQQQAKXJIHRQHQ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |