C23H20N2O3 — CID 162674614
7-pyridin-4-yl-3-(3,4,5-trimethoxyphenyl)quinoline (PubChem CID 162674614) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is 7-pyridin-4-yl-3-(3,4,5-trimethoxyphenyl)quinoline.
| Compound Name | 7-pyridin-4-yl-3-(3,4,5-trimethoxyphenyl)quinoline |
|---|---|
| PubChem CID | 162674614 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | 7-pyridin-4-yl-3-(3,4,5-trimethoxyphenyl)quinoline |
| SMILES | COc1cc(-c2cnc3cc(-c4ccncc4)ccc3c2)cc(OC)c1OC |
| InChI | InChI=1S/C23H20N2O3/c1-26-21-12-18(13-22(27-2)23(21)28-3)19-10-17-5-4-16(11-20(17)25-14-19)15-6-8-24-9-7-15/h4-14H,1-3H3 |
| InChIKey | ZGGVZWZAZUBRKG-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |