C11H12N2O3S — CID 141080417
2-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazole (PubChem CID 141080417) has the molecular formula C11H12N2O3S and a molecular weight of 252.29 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazole.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 141080417 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)-1,3,4-thiadiazole |
| SMILES | COc1cc(-c2nncs2)cc(OC)c1OC |
| InChI | InChI=1S/C11H12N2O3S/c1-14-8-4-7(11-13-12-6-17-11)5-9(15-2)10(8)16-3/h4-6H,1-3H3 |
| InChIKey | HWRLZXXGSAHLJX-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |