C10H10N2O3 — CID 76849673
methyl 7-methoxyimidazo[1,2-a]pyridine-6-carboxylate (PubChem CID 76849673) has the molecular formula C10H10N2O3 and a molecular weight of 206.20 g/mol. Its IUPAC name is methyl 7-methoxyimidazo[1,2-a]pyridine-6-carboxylate.
| Compound Name | methyl 7-methoxyimidazo[1,2-a]pyridine-6-carboxylate |
|---|---|
| PubChem CID | 76849673 |
| Molecular Formula | C10H10N2O3 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | methyl 7-methoxyimidazo[1,2-a]pyridine-6-carboxylate |
| SMILES | COC(=O)c1cn2ccnc2cc1OC |
| InChI | InChI=1S/C10H10N2O3/c1-14-8-5-9-11-3-4-12(9)6-7(8)10(13)15-2/h3-6H,1-2H3 |
| InChIKey | GOAXTDXUEGHEHO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |