C9H7ClN2O2 — CID 146193908
methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate (PubChem CID 146193908) has the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. Its IUPAC name is methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate.
| Compound Name | methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 146193908 |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.62 g/mol |
| Exact Mass | 210.02 |
| IUPAC Name | methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate |
| SMILES | COC(=O)c1cc2nccn2cc1Cl |
| InChI | InChI=1S/C9H7ClN2O2/c1-14-9(13)6-4-8-11-2-3-12(8)5-7(6)10/h2-5H,1H3 |
| InChIKey | TTZRTEQNJBSWQZ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.62 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |