methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate

C9H7ClN2O2 — CID 146193908

IUPACmethyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate
SMILESCOC(=O)c1cc2nccn2cc1Cl
InChIInChI=1S/C9H7ClN2O2/c1-14-9(13)6-4-8-11-2-3-12(8)5-7(6)10/h2-5H,1H3
InChIKeyTTZRTEQNJBSWQZ-UHFFFAOYSA-N
MW210.62 g/mol
LogP1.77
Rot. Bonds1

About methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate

methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate (PubChem CID 146193908) has the molecular formula C9H7ClN2O2 and a molecular weight of 210.62 g/mol. Its IUPAC name is methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate.

Molecular Properties

Compound Namemethyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate
PubChem CID146193908
Molecular FormulaC9H7ClN2O2
Molecular Weight210.62 g/mol
Exact Mass210.02
IUPAC Namemethyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate
SMILESCOC(=O)c1cc2nccn2cc1Cl
InChIInChI=1S/C9H7ClN2O2/c1-14-9(13)6-4-8-11-2-3-12(8)5-7(6)10/h2-5H,1H3
InChIKeyTTZRTEQNJBSWQZ-UHFFFAOYSA-N
XLogP1.77
TPSA43.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.62
LogP ≤ 51.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate?
The IUPAC name of methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate (CID 146193908) is methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate.
What is the SMILES notation for methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate?
The canonical SMILES for methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate is COC(=O)c1cc2nccn2cc1Cl.
What is the InChIKey of methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate?
The InChIKey is TTZRTEQNJBSWQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O2/c1-14-9(13)6-4-8-11-2-3-12(8)5-7(6)10/h2-5H,1H3.
What are the key properties of methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate?
methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate has a molecular weight of 210.62 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloroimidazo[1,2-a]pyridine-7-carboxylate is sourced from PubChem (CID 146193908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).