C12H13F3N2O5S2 — CID 172632230
(6-tert-butylsulfonylimidazo[1,2-a]pyridin-7-yl) trifluoromethanesulfonate (PubChem CID 172632230) has the molecular formula C12H13F3N2O5S2 and a molecular weight of 386.37 g/mol. Its IUPAC name is (6-tert-butylsulfonylimidazo[1,2-a]pyridin-7-yl) trifluoromethanesulfonate.
| Compound Name | (6-tert-butylsulfonylimidazo[1,2-a]pyridin-7-yl) trifluoromethanesulfonate |
|---|---|
| PubChem CID | 172632230 |
| Molecular Formula | C12H13F3N2O5S2 |
| Molecular Weight | 386.37 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | (6-tert-butylsulfonylimidazo[1,2-a]pyridin-7-yl) trifluoromethanesulfonate |
| SMILES | CC(C)(C)S(=O)(=O)c1cn2ccnc2cc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H13F3N2O5S2/c1-11(2,3)23(18,19)9-7-17-5-4-16-10(17)6-8(9)22-24(20,21)12(13,14)15/h4-7H,1-3H3 |
| InChIKey | RGLJLOHNNXEXCZ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 94.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.37 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|