C12H16N2O2S — CID 134366014
6-tert-butylsulfinyl-7-methoxyimidazo[1,2-a]pyridine (PubChem CID 134366014) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 6-tert-butylsulfinyl-7-methoxyimidazo[1,2-a]pyridine.
| Compound Name | 6-tert-butylsulfinyl-7-methoxyimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 134366014 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 6-tert-butylsulfinyl-7-methoxyimidazo[1,2-a]pyridine |
| SMILES | COc1cc2nccn2cc1S(=O)C(C)(C)C |
| InChI | InChI=1S/C12H16N2O2S/c1-12(2,3)17(15)10-8-14-6-5-13-11(14)7-9(10)16-4/h5-8H,1-4H3 |
| InChIKey | QLHJQFJDZLRIQI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |