C17H17N2O4S- — CID 172632025
7-[(2S)-1-phenylmethoxypropan-2-yl]oxyimidazo[1,2-a]pyridine-6-sulfinate (PubChem CID 172632025) has the molecular formula C17H17N2O4S- and a molecular weight of 345.40 g/mol. Its IUPAC name is 7-[(2S)-1-phenylmethoxypropan-2-yl]oxyimidazo[1,2-a]pyridine-6-sulfinate.
| Compound Name | 7-[(2S)-1-phenylmethoxypropan-2-yl]oxyimidazo[1,2-a]pyridine-6-sulfinate |
|---|---|
| PubChem CID | 172632025 |
| Molecular Formula | C17H17N2O4S- |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 7-[(2S)-1-phenylmethoxypropan-2-yl]oxyimidazo[1,2-a]pyridine-6-sulfinate |
| SMILES | C[C@@H](COCc1ccccc1)Oc1cc2nccn2cc1S(=O)[O-] |
| InChI | InChI=1S/C17H18N2O4S/c1-13(11-22-12-14-5-3-2-4-6-14)23-15-9-17-18-7-8-19(17)10-16(15)24(20)21/h2-10,13H,11-12H2,1H3,(H,20,21)/p-1/t13-/m0/s1 |
| InChIKey | NNIOXSSWUAXFDM-ZDUSSCGKSA-M |
| XLogP | 2.56 |
| TPSA | 75.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|