C17H31N2O+ — CID 144943963
ethane;1-methoxy-1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepan-1-ium (PubChem CID 144943963) has the molecular formula C17H31N2O+ and a molecular weight of 279.45 g/mol. Its IUPAC name is ethane;1-methoxy-1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepan-1-ium.
| Compound Name | ethane;1-methoxy-1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepan-1-ium |
|---|---|
| PubChem CID | 144943963 |
| Molecular Formula | C17H31N2O+ |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | ethane;1-methoxy-1-methyl-4-[(4-methylphenyl)methyl]-1,4-diazepan-1-ium |
| SMILES | CC.CO[N+]1(C)CCCN(Cc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C15H25N2O.C2H6/c1-14-5-7-15(8-6-14)13-16-9-4-11-17(2,18-3)12-10-16;1-2/h5-8H,4,9-13H2,1-3H3;1-2H3/q+1; |
| InChIKey | CNYOZOLEAJKEMX-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|