C39H84N8O10 — CID 144945660
1,5-bis[3-[2-[2-[3-[(1-hydroxy-3-piperazin-1-ylpropyl)amino]propoxy]ethoxy]ethoxy]propylamino]pentane-1,5-diol (PubChem CID 144945660) has the molecular formula C39H84N8O10 and a molecular weight of 825.15 g/mol. Its IUPAC name is 1,5-bis[3-[2-[2-[3-[(1-hydroxy-3-piperazin-1-ylpropyl)amino]propoxy]ethoxy]ethoxy]propylamino]pentane-1,5-diol.
| Compound Name | 1,5-bis[3-[2-[2-[3-[(1-hydroxy-3-piperazin-1-ylpropyl)amino]propoxy]ethoxy]ethoxy]propylamino]pentane-1,5-diol |
|---|---|
| PubChem CID | 144945660 |
| Molecular Formula | C39H84N8O10 |
| Molecular Weight | 825.15 g/mol |
| Exact Mass | 824.63 |
| IUPAC Name | 1,5-bis[3-[2-[2-[3-[(1-hydroxy-3-piperazin-1-ylpropyl)amino]propoxy]ethoxy]ethoxy]propylamino]pentane-1,5-diol |
| SMILES | OC(CCCC(O)NCCCOCCOCCOCCCNC(O)CCN1CCNCC1)NCCCOCCOCCOCCCNC(O)CCN1CCNCC1 |
| InChI | InChI=1S/C39H84N8O10/c48-36(42-10-2-24-52-28-32-56-34-30-54-26-4-12-44-38(50)8-18-46-20-14-40-15-21-46)6-1-7-37(49)43-11-3-25-53-29-33-57-35-31-55-27-5-13-45-39(51)9-19-47-22-16-41-17-23-47/h36-45,48-51H,1-35H2 |
| InChIKey | ACWUPVLVGALBRA-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 214.96 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.15 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|