C19H20F3NO2S — CID 144945996
2-methoxy-5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyridine (PubChem CID 144945996) has the molecular formula C19H20F3NO2S and a molecular weight of 383.44 g/mol. Its IUPAC name is 2-methoxy-5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyridine.
| Compound Name | 2-methoxy-5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyridine |
|---|---|
| PubChem CID | 144945996 |
| Molecular Formula | C19H20F3NO2S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-methoxy-5-[4-methyl-4-[3-(trifluoromethyl)phenyl]sulfanyloxan-2-yl]pyridine |
| SMILES | COc1ccc(C2CC(C)(Sc3cccc(C(F)(F)F)c3)CCO2)cn1 |
| InChI | InChI=1S/C19H20F3NO2S/c1-18(26-15-5-3-4-14(10-15)19(20,21)22)8-9-25-16(11-18)13-6-7-17(24-2)23-12-13/h3-7,10,12,16H,8-9,11H2,1-2H3 |
| InChIKey | JQICBMBDERZWGN-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |