C15H30O2 — CID 144946376
(2S)-3-(2,5-dimethylcyclohexyl)oxybut-3-en-2-ol;propane (PubChem CID 144946376) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is (2S)-3-(2,5-dimethylcyclohexyl)oxybut-3-en-2-ol;propane.
| Compound Name | (2S)-3-(2,5-dimethylcyclohexyl)oxybut-3-en-2-ol;propane |
|---|---|
| PubChem CID | 144946376 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | (2S)-3-(2,5-dimethylcyclohexyl)oxybut-3-en-2-ol;propane |
| SMILES | C=C(OC1CC(C)CCC1C)[C@H](C)O.CCC |
| InChI | InChI=1S/C12H22O2.C3H8/c1-8-5-6-9(2)12(7-8)14-11(4)10(3)13;1-3-2/h8-10,12-13H,4-7H2,1-3H3;3H2,1-2H3/t8?,9?,10-,12?;/m0./s1 |
| InChIKey | WWHRNYXBUJYBFW-KAPOTKQRSA-N |
| XLogP | 4.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|