C18H38S2 — CID 144946837
ethane;2-[(5-ethyl-2,4,4-trimethyloctan-2-yl)sulfanylmethyl]thiirane (PubChem CID 144946837) has the molecular formula C18H38S2 and a molecular weight of 318.64 g/mol. Its IUPAC name is ethane;2-[(5-ethyl-2,4,4-trimethyloctan-2-yl)sulfanylmethyl]thiirane.
| Compound Name | ethane;2-[(5-ethyl-2,4,4-trimethyloctan-2-yl)sulfanylmethyl]thiirane |
|---|---|
| PubChem CID | 144946837 |
| Molecular Formula | C18H38S2 |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | ethane;2-[(5-ethyl-2,4,4-trimethyloctan-2-yl)sulfanylmethyl]thiirane |
| SMILES | CC.CCCC(CC)C(C)(C)CC(C)(C)SCC1CS1 |
| InChI | InChI=1S/C16H32S2.C2H6/c1-7-9-13(8-2)15(3,4)12-16(5,6)18-11-14-10-17-14;1-2/h13-14H,7-12H2,1-6H3;1-2H3 |
| InChIKey | HJQPUCYLANVZAR-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|