C14H30S — CID 170069661
2,4,4-trimethyl-2-(2-methylbutylsulfanyl)hexane (PubChem CID 170069661) has the molecular formula C14H30S and a molecular weight of 230.46 g/mol. Its IUPAC name is 2,4,4-trimethyl-2-(2-methylbutylsulfanyl)hexane.
| Compound Name | 2,4,4-trimethyl-2-(2-methylbutylsulfanyl)hexane |
|---|---|
| PubChem CID | 170069661 |
| Molecular Formula | C14H30S |
| Molecular Weight | 230.46 g/mol |
| Exact Mass | 230.21 |
| IUPAC Name | 2,4,4-trimethyl-2-(2-methylbutylsulfanyl)hexane |
| SMILES | CCC(C)CSC(C)(C)CC(C)(C)CC |
| InChI | InChI=1S/C14H30S/c1-8-12(3)10-15-14(6,7)11-13(4,5)9-2/h12H,8-11H2,1-7H3 |
| InChIKey | VGSXCNWNLXMLLW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |