C16H35NS2 — CID 171508665
2,4-dimethyl-4-(2,4,4-trimethylhexan-2-yldisulfanyl)pentan-2-amine (PubChem CID 171508665) has the molecular formula C16H35NS2 and a molecular weight of 305.60 g/mol. Its IUPAC name is 2,4-dimethyl-4-(2,4,4-trimethylhexan-2-yldisulfanyl)pentan-2-amine.
| Compound Name | 2,4-dimethyl-4-(2,4,4-trimethylhexan-2-yldisulfanyl)pentan-2-amine |
|---|---|
| PubChem CID | 171508665 |
| Molecular Formula | C16H35NS2 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 305.22 |
| IUPAC Name | 2,4-dimethyl-4-(2,4,4-trimethylhexan-2-yldisulfanyl)pentan-2-amine |
| SMILES | CCC(C)(C)CC(C)(C)SSC(C)(C)CC(C)(C)N |
| InChI | InChI=1S/C16H35NS2/c1-10-13(2,3)11-15(6,7)18-19-16(8,9)12-14(4,5)17/h10-12,17H2,1-9H3 |
| InChIKey | TVFPONVOJNLEQB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|