C18H26S2 — CID 135224519
2-[[(5E,6Z)-2,4,4-trimethyl-5-prop-2-ynylidenenona-6,8-dien-2-yl]sulfanylmethyl]thiirane (PubChem CID 135224519) has the molecular formula C18H26S2 and a molecular weight of 306.54 g/mol. Its IUPAC name is 2-[[(5E,6Z)-2,4,4-trimethyl-5-prop-2-ynylidenenona-6,8-dien-2-yl]sulfanylmethyl]thiirane.
| Compound Name | 2-[[(5E,6Z)-2,4,4-trimethyl-5-prop-2-ynylidenenona-6,8-dien-2-yl]sulfanylmethyl]thiirane |
|---|---|
| PubChem CID | 135224519 |
| Molecular Formula | C18H26S2 |
| Molecular Weight | 306.54 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-[[(5E,6Z)-2,4,4-trimethyl-5-prop-2-ynylidenenona-6,8-dien-2-yl]sulfanylmethyl]thiirane |
| SMILES | C#C/C=C(\C=C/C=C)C(C)(C)CC(C)(C)SCC1CS1 |
| InChI | InChI=1S/C18H26S2/c1-7-9-11-15(10-8-2)17(3,4)14-18(5,6)20-13-16-12-19-16/h2,7,9-11,16H,1,12-14H2,3-6H3/b11-9-,15-10+ |
| InChIKey | PIEAOKDOMNULRC-LFHBGGBDSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|