C37H40N2O4 — CID 144948716
2-(4-ethylphenyl)benzoic acid;(1R)-N-[1-[4-methyl-3-(3-methylbut-2-en-2-yl)phenyl]ethenyl]-1-(4-nitrophenyl)ethanamine (PubChem CID 144948716) has the molecular formula C37H40N2O4 and a molecular weight of 576.74 g/mol. Its IUPAC name is 2-(4-ethylphenyl)benzoic acid;(1R)-N-[1-[4-methyl-3-(3-methylbut-2-en-2-yl)phenyl]ethenyl]-1-(4-nitrophenyl)ethanamine.
| Compound Name | 2-(4-ethylphenyl)benzoic acid;(1R)-N-[1-[4-methyl-3-(3-methylbut-2-en-2-yl)phenyl]ethenyl]-1-(4-nitrophenyl)ethanamine |
|---|---|
| PubChem CID | 144948716 |
| Molecular Formula | C37H40N2O4 |
| Molecular Weight | 576.74 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | 2-(4-ethylphenyl)benzoic acid;(1R)-N-[1-[4-methyl-3-(3-methylbut-2-en-2-yl)phenyl]ethenyl]-1-(4-nitrophenyl)ethanamine |
| SMILES | C=C(N[C@H](C)c1ccc([N+](=O)[O-])cc1)c1ccc(C)c(C(C)=C(C)C)c1.CCc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C22H26N2O2.C15H14O2/c1-14(2)16(4)22-13-20(8-7-15(22)3)18(6)23-17(5)19-9-11-21(12-10-19)24(25)26;1-2-11-7-9-12(10-8-11)13-5-3-4-6-14(13)15(16)17/h7-13,17,23H,6H2,1-5H3;3-10H,2H2,1H3,(H,16,17)/t17-;/m1./s1 |
| InChIKey | MIMYXSONFNXHMW-UNTBIKODSA-N |
| XLogP | 9.65 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.74 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|